About N-[(3,4-dichlorophenyl)methyl]ethanamine;hydrochloride
N-[(3,4-dichlorophenyl)methyl]ethanamine;hydrochloride (PubChem CID 17293895) has the molecular formula C9H12Cl3N
and a molecular weight of 240.56 g/mol. Its IUPAC name is N-[(3,4-dichlorophenyl)methyl]ethanamine;hydrochloride.
Molecular Properties
| Compound Name | N-[(3,4-dichlorophenyl)methyl]ethanamine;hydrochloride |
| PubChem CID | 17293895 |
| Molecular Formula | C9H12Cl3N |
| Molecular Weight | 240.56 g/mol |
| Exact Mass | 239.00 |
| IUPAC Name | N-[(3,4-dichlorophenyl)methyl]ethanamine;hydrochloride |
| SMILES | CCNCc1ccc(Cl)c(Cl)c1.Cl |
| InChI | InChI=1S/C9H11Cl2N.ClH/c1-2-12-6-7-3-4-8(10)9(11)5-7;/h3-5,12H,2,6H2,1H3;1H |
| InChIKey | HASMVVHCPCKYTJ-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.56 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-[(3,4-dichlorophenyl)methyl]ethanamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3,4-dichlorophenyl)methyl]ethanamine;hydrochloride?
The IUPAC name of N-[(3,4-dichlorophenyl)methyl]ethanamine;hydrochloride (CID 17293895) is N-[(3,4-dichlorophenyl)methyl]ethanamine;hydrochloride.
What is the SMILES notation for N-[(3,4-dichlorophenyl)methyl]ethanamine;hydrochloride?
The canonical SMILES for N-[(3,4-dichlorophenyl)methyl]ethanamine;hydrochloride is CCNCc1ccc(Cl)c(Cl)c1.Cl.
What is the InChIKey of N-[(3,4-dichlorophenyl)methyl]ethanamine;hydrochloride?
The InChIKey is HASMVVHCPCKYTJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11Cl2N.ClH/c1-2-12-6-7-3-4-8(10)9(11)5-7;/h3-5,12H,2,6H2,1H3;1H.
What are the key properties of N-[(3,4-dichlorophenyl)methyl]ethanamine;hydrochloride?
N-[(3,4-dichlorophenyl)methyl]ethanamine;hydrochloride has a molecular weight of 240.56 g/mol, XLogP of 3.52, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3,4-dichlorophenyl)methyl]ethanamine;hydrochloride is sourced from PubChem (CID 17293895), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).