C12H20FN3 — CID 172940092
(1E,2R)-N-[3-(4-fluorocyclohexa-1,3-dien-1-yl)propyl]-1-hydrazinylidenepropan-2-amine (PubChem CID 172940092) has the molecular formula C12H20FN3 and a molecular weight of 225.31 g/mol. Its IUPAC name is (1E,2R)-N-[3-(4-fluorocyclohexa-1,3-dien-1-yl)propyl]-1-hydrazinylidenepropan-2-amine.
| Compound Name | (1E,2R)-N-[3-(4-fluorocyclohexa-1,3-dien-1-yl)propyl]-1-hydrazinylidenepropan-2-amine |
|---|---|
| PubChem CID | 172940092 |
| Molecular Formula | C12H20FN3 |
| Molecular Weight | 225.31 g/mol |
| Exact Mass | 225.16 |
| IUPAC Name | (1E,2R)-N-[3-(4-fluorocyclohexa-1,3-dien-1-yl)propyl]-1-hydrazinylidenepropan-2-amine |
| SMILES | C[C@H](/C=N/N)NCCCC1=CC=C(F)CC1 |
| InChI | InChI=1S/C12H20FN3/c1-10(9-16-14)15-8-2-3-11-4-6-12(13)7-5-11/h4,6,9-10,15H,2-3,5,7-8,14H2,1H3/b16-9+/t10-/m1/s1 |
| InChIKey | VATARAFOKVIAQK-VCBXAZPMSA-N |
| XLogP | 2.26 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.31 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|