C27H31Cl2N3O5 — CID 172940659
(1R,2R)-2-[[(2E)-2-(5-chloro-1-benzofuran-2-yl)-2-hydroxyimino-1-methoxyethyl]amino]-1-(3-chloro-4-cyclopropyloxyphenyl)-3-pyrrolidin-1-ylpropan-1-ol (PubChem CID 172940659) has the molecular formula C27H31Cl2N3O5 and a molecular weight of 548.47 g/mol. Its IUPAC name is (1R,2R)-2-[[(2E)-2-(5-chloro-1-benzofuran-2-yl)-2-hydroxyimino-1-methoxyethyl]amino]-1-(3-chloro-4-cyclopropyloxyphenyl)-3-pyrrolidin-1-ylpropan-1-ol.
| Compound Name | (1R,2R)-2-[[(2E)-2-(5-chloro-1-benzofuran-2-yl)-2-hydroxyimino-1-methoxyethyl]amino]-1-(3-chloro-4-cyclopropyloxyphenyl)-3-pyrrolidin-1-ylpropan-1-ol |
|---|---|
| PubChem CID | 172940659 |
| Molecular Formula | C27H31Cl2N3O5 |
| Molecular Weight | 548.47 g/mol |
| Exact Mass | 547.16 |
| IUPAC Name | (1R,2R)-2-[[(2E)-2-(5-chloro-1-benzofuran-2-yl)-2-hydroxyimino-1-methoxyethyl]amino]-1-(3-chloro-4-cyclopropyloxyphenyl)-3-pyrrolidin-1-ylpropan-1-ol |
| SMILES | COC(N[C@H](CN1CCCC1)[C@H](O)c1ccc(OC2CC2)c(Cl)c1)/C(=N/O)c1cc2cc(Cl)ccc2o1 |
| InChI | InChI=1S/C27H31Cl2N3O5/c1-35-27(25(31-34)24-14-17-12-18(28)5-9-22(17)37-24)30-21(15-32-10-2-3-11-32)26(33)16-4-8-23(20(29)13-16)36-19-6-7-19/h4-5,8-9,12-14,19,21,26-27,30,33-34H,2-3,6-7,10-11,15H2,1H3/b31-25+/t21-,26-,27?/m1/s1 |
| InChIKey | JZDYQSBMLRJALM-ZRGFPAPOSA-N |
| XLogP | 5.22 |
| TPSA | 99.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.47 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|