C33H37N5O7S — CID 172940744
benzyl 4-[2-[(2S,4S)-1-[4-[(Z)-N'-hydroxycarbamimidoyl]benzoyl]-4-(4-methylsulfonylpiperazin-1-yl)pyrrolidin-2-yl]-2-oxoethyl]benzoate (PubChem CID 172940744) has the molecular formula C33H37N5O7S and a molecular weight of 647.75 g/mol. Its IUPAC name is benzyl 4-[2-[(2S,4S)-1-[4-[(Z)-N'-hydroxycarbamimidoyl]benzoyl]-4-(4-methylsulfonylpiperazin-1-yl)pyrrolidin-2-yl]-2-oxoethyl]benzoate.
| Compound Name | benzyl 4-[2-[(2S,4S)-1-[4-[(Z)-N'-hydroxycarbamimidoyl]benzoyl]-4-(4-methylsulfonylpiperazin-1-yl)pyrrolidin-2-yl]-2-oxoethyl]benzoate |
|---|---|
| PubChem CID | 172940744 |
| Molecular Formula | C33H37N5O7S |
| Molecular Weight | 647.75 g/mol |
| Exact Mass | 647.24 |
| IUPAC Name | benzyl 4-[2-[(2S,4S)-1-[4-[(Z)-N'-hydroxycarbamimidoyl]benzoyl]-4-(4-methylsulfonylpiperazin-1-yl)pyrrolidin-2-yl]-2-oxoethyl]benzoate |
| SMILES | CS(=O)(=O)N1CCN([C@H]2C[C@@H](C(=O)Cc3ccc(C(=O)OCc4ccccc4)cc3)N(C(=O)c3ccc(/C(N)=N/O)cc3)C2)CC1 |
| InChI | InChI=1S/C33H37N5O7S/c1-46(43,44)37-17-15-36(16-18-37)28-20-29(38(21-28)32(40)26-13-11-25(12-14-26)31(34)35-42)30(39)19-23-7-9-27(10-8-23)33(41)45-22-24-5-3-2-4-6-24/h2-14,28-29,42H,15-22H2,1H3,(H2,34,35)/t28-,29-/m0/s1 |
| InChIKey | KFHGQZLKPHVEQT-VMPREFPWSA-N |
| XLogP | 2.11 |
| TPSA | 162.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.75 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|