C25H32ClN3O6SSi — CID 172941658
10-O-propyl 9-O-(2-trimethylsilylethyl) (1R,9R,10R,11E)-11-[(5-chlorothiadiazol-4-yl)methoxyimino]-4-hydroxytricyclo[6.2.2.02,7]dodeca-2(7),3,5-triene-9,10-dicarboxylate (PubChem CID 172941658) has the molecular formula C25H32ClN3O6SSi and a molecular weight of 566.15 g/mol. Its IUPAC name is 10-O-propyl 9-O-(2-trimethylsilylethyl) (1R,9R,10R,11E)-11-[(5-chlorothiadiazol-4-yl)methoxyimino]-4-hydroxytricyclo[6.2.2.02,7]dodeca-2(7),3,5-triene-9,10-dicarboxylate.
| Compound Name | 10-O-propyl 9-O-(2-trimethylsilylethyl) (1R,9R,10R,11E)-11-[(5-chlorothiadiazol-4-yl)methoxyimino]-4-hydroxytricyclo[6.2.2.02,7]dodeca-2(7),3,5-triene-9,10-dicarboxylate |
|---|---|
| PubChem CID | 172941658 |
| Molecular Formula | C25H32ClN3O6SSi |
| Molecular Weight | 566.15 g/mol |
| Exact Mass | 565.15 |
| IUPAC Name | 10-O-propyl 9-O-(2-trimethylsilylethyl) (1R,9R,10R,11E)-11-[(5-chlorothiadiazol-4-yl)methoxyimino]-4-hydroxytricyclo[6.2.2.02,7]dodeca-2(7),3,5-triene-9,10-dicarboxylate |
| SMILES | CCCOC(=O)[C@H]1[C@H](C(=O)OCC[Si](C)(C)C)C2C/C(=N\OCc3nnsc3Cl)[C@H]1c1cc(O)ccc12 |
| InChI | InChI=1S/C25H32ClN3O6SSi/c1-5-8-33-25(32)22-20-16-11-14(30)6-7-15(16)17(21(22)24(31)34-9-10-37(2,3)4)12-18(20)28-35-13-19-23(26)36-29-27-19/h6-7,11,17,20-22,30H,5,8-10,12-13H2,1-4H3/b28-18+/t17?,20-,21-,22-/m1/s1 |
| InChIKey | RIVNXULRIUXNDJ-TZHIMGOHSA-N |
| XLogP | 5.12 |
| TPSA | 120.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.15 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|