C33H31N5O4 — CID 172942737
(6-but-2-ynoxypyrimidin-4-yl)-phenylmethanone;(E)-1-(6-but-2-ynoxypyrimidin-4-yl)-1-phenyl-N-propan-2-yloxymethanimine (PubChem CID 172942737) has the molecular formula C33H31N5O4 and a molecular weight of 561.64 g/mol. Its IUPAC name is (6-but-2-ynoxypyrimidin-4-yl)-phenylmethanone;(E)-1-(6-but-2-ynoxypyrimidin-4-yl)-1-phenyl-N-propan-2-yloxymethanimine.
| Compound Name | (6-but-2-ynoxypyrimidin-4-yl)-phenylmethanone;(E)-1-(6-but-2-ynoxypyrimidin-4-yl)-1-phenyl-N-propan-2-yloxymethanimine |
|---|---|
| PubChem CID | 172942737 |
| Molecular Formula | C33H31N5O4 |
| Molecular Weight | 561.64 g/mol |
| Exact Mass | 561.24 |
| IUPAC Name | (6-but-2-ynoxypyrimidin-4-yl)-phenylmethanone;(E)-1-(6-but-2-ynoxypyrimidin-4-yl)-1-phenyl-N-propan-2-yloxymethanimine |
| SMILES | CC#CCOc1cc(/C(=N/OC(C)C)c2ccccc2)ncn1.CC#CCOc1cc(C(=O)c2ccccc2)ncn1 |
| InChI | InChI=1S/C18H19N3O2.C15H12N2O2/c1-4-5-11-22-17-12-16(19-13-20-17)18(21-23-14(2)3)15-9-7-6-8-10-15;1-2-3-9-19-14-10-13(16-11-17-14)15(18)12-7-5-4-6-8-12/h6-10,12-14H,11H2,1-3H3;4-8,10-11H,9H2,1H3/b21-18+; |
| InChIKey | JKWQBTWLVJYMSB-GOSREXKOSA-N |
| XLogP | 5.17 |
| TPSA | 108.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.64 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|