C17H19N7O8S2 — CID 172942968
1-[(Z)-[1-(2-amino-1,3-thiazol-4-yl)-2-oxo-3-[(3S,4S)-2-oxo-1-sulfo-4-(1,2,4-triazol-1-ylmethyl)azetidin-3-yl]propylidene]amino]oxycyclobutane-1-carboxylic acid (PubChem CID 172942968) has the molecular formula C17H19N7O8S2 and a molecular weight of 513.51 g/mol. Its IUPAC name is 1-[(Z)-[1-(2-amino-1,3-thiazol-4-yl)-2-oxo-3-[(3S,4S)-2-oxo-1-sulfo-4-(1,2,4-triazol-1-ylmethyl)azetidin-3-yl]propylidene]amino]oxycyclobutane-1-carboxylic acid.
| Compound Name | 1-[(Z)-[1-(2-amino-1,3-thiazol-4-yl)-2-oxo-3-[(3S,4S)-2-oxo-1-sulfo-4-(1,2,4-triazol-1-ylmethyl)azetidin-3-yl]propylidene]amino]oxycyclobutane-1-carboxylic acid |
|---|---|
| PubChem CID | 172942968 |
| Molecular Formula | C17H19N7O8S2 |
| Molecular Weight | 513.51 g/mol |
| Exact Mass | 513.07 |
| IUPAC Name | 1-[(Z)-[1-(2-amino-1,3-thiazol-4-yl)-2-oxo-3-[(3S,4S)-2-oxo-1-sulfo-4-(1,2,4-triazol-1-ylmethyl)azetidin-3-yl]propylidene]amino]oxycyclobutane-1-carboxylic acid |
| SMILES | Nc1nc(/C(=N/OC2(C(=O)O)CCC2)C(=O)C[C@@H]2C(=O)N(S(=O)(=O)O)[C@@H]2Cn2cncn2)cs1 |
| InChI | InChI=1S/C17H19N7O8S2/c18-16-21-10(6-33-16)13(22-32-17(15(27)28)2-1-3-17)12(25)4-9-11(5-23-8-19-7-20-23)24(14(9)26)34(29,30)31/h6-9,11H,1-5H2,(H2,18,21)(H,27,28)(H,29,30,31)/b22-13-/t9-,11+/m0/s1 |
| InChIKey | VOOTUDWCYCPTAO-MSIWHPBPSA-N |
| XLogP | -0.67 |
| TPSA | 220.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.51 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|