C7H8F3NOS — CID 172943162
(NE)-N-[2,2,2-trifluoro-1-(3-methyl-2,3-dihydrothiophen-2-yl)ethylidene]hydroxylamine (PubChem CID 172943162) has the molecular formula C7H8F3NOS and a molecular weight of 211.21 g/mol. Its IUPAC name is (NE)-N-[2,2,2-trifluoro-1-(3-methyl-2,3-dihydrothiophen-2-yl)ethylidene]hydroxylamine.
| Compound Name | (NE)-N-[2,2,2-trifluoro-1-(3-methyl-2,3-dihydrothiophen-2-yl)ethylidene]hydroxylamine |
|---|---|
| PubChem CID | 172943162 |
| Molecular Formula | C7H8F3NOS |
| Molecular Weight | 211.21 g/mol |
| Exact Mass | 211.03 |
| IUPAC Name | (NE)-N-[2,2,2-trifluoro-1-(3-methyl-2,3-dihydrothiophen-2-yl)ethylidene]hydroxylamine |
| SMILES | CC1C=CSC1/C(=N/O)C(F)(F)F |
| InChI | InChI=1S/C7H8F3NOS/c1-4-2-3-13-5(4)6(11-12)7(8,9)10/h2-5,12H,1H3/b11-6- |
| InChIKey | FBMZMONEMDAIHT-WDZFZDKYSA-N |
| XLogP | 2.64 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.21 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|