About (5Z)-5-methoxyimino-4a,6,7,8-tetrahydroquinolin-2-one
(5Z)-5-methoxyimino-4a,6,7,8-tetrahydroquinolin-2-one (PubChem CID 172943365) has the molecular formula C10H12N2O2
and a molecular weight of 192.22 g/mol. Its IUPAC name is (5Z)-5-methoxyimino-4a,6,7,8-tetrahydroquinolin-2-one.
Molecular Properties
| Compound Name | (5Z)-5-methoxyimino-4a,6,7,8-tetrahydroquinolin-2-one |
| PubChem CID | 172943365 |
| Molecular Formula | C10H12N2O2 |
| Molecular Weight | 192.22 g/mol |
| Exact Mass | 192.09 |
| IUPAC Name | (5Z)-5-methoxyimino-4a,6,7,8-tetrahydroquinolin-2-one |
| SMILES | CO/N=C1/CCCC2=NC(=O)C=CC21 |
| InChI | InChI=1S/C10H12N2O2/c1-14-12-9-4-2-3-8-7(9)5-6-10(13)11-8/h5-7H,2-4H2,1H3/b12-9- |
| InChIKey | SGNCWKGFMXYEIA-XFXZXTDPSA-N |
| XLogP | 1.33 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.22 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (5Z)-5-methoxyimino-4a,6,7,8-tetrahydroquinolin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5Z)-5-methoxyimino-4a,6,7,8-tetrahydroquinolin-2-one?
The IUPAC name of (5Z)-5-methoxyimino-4a,6,7,8-tetrahydroquinolin-2-one (CID 172943365) is (5Z)-5-methoxyimino-4a,6,7,8-tetrahydroquinolin-2-one.
What is the SMILES notation for (5Z)-5-methoxyimino-4a,6,7,8-tetrahydroquinolin-2-one?
The canonical SMILES for (5Z)-5-methoxyimino-4a,6,7,8-tetrahydroquinolin-2-one is CO/N=C1/CCCC2=NC(=O)C=CC21.
What is the InChIKey of (5Z)-5-methoxyimino-4a,6,7,8-tetrahydroquinolin-2-one?
The InChIKey is SGNCWKGFMXYEIA-XFXZXTDPSA-N. The full InChI is InChI=1S/C10H12N2O2/c1-14-12-9-4-2-3-8-7(9)5-6-10(13)11-8/h5-7H,2-4H2,1H3/b12-9-.
What are the key properties of (5Z)-5-methoxyimino-4a,6,7,8-tetrahydroquinolin-2-one?
(5Z)-5-methoxyimino-4a,6,7,8-tetrahydroquinolin-2-one has a molecular weight of 192.22 g/mol, XLogP of 1.33, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5Z)-5-methoxyimino-4a,6,7,8-tetrahydroquinolin-2-one is sourced from PubChem (CID 172943365), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).