C34H31F3N2O6 — CID 172944536
[(Z)-[1-[6-(cyclohexanecarbonyl)-9-(2,2,2-trifluoroethyl)carbazol-3-yl]-5-methoxy-1,5-dioxopentan-2-ylidene]amino] benzoate (PubChem CID 172944536) has the molecular formula C34H31F3N2O6 and a molecular weight of 620.62 g/mol. Its IUPAC name is [(Z)-[1-[6-(cyclohexanecarbonyl)-9-(2,2,2-trifluoroethyl)carbazol-3-yl]-5-methoxy-1,5-dioxopentan-2-ylidene]amino] benzoate.
| Compound Name | [(Z)-[1-[6-(cyclohexanecarbonyl)-9-(2,2,2-trifluoroethyl)carbazol-3-yl]-5-methoxy-1,5-dioxopentan-2-ylidene]amino] benzoate |
|---|---|
| PubChem CID | 172944536 |
| Molecular Formula | C34H31F3N2O6 |
| Molecular Weight | 620.62 g/mol |
| Exact Mass | 620.21 |
| IUPAC Name | [(Z)-[1-[6-(cyclohexanecarbonyl)-9-(2,2,2-trifluoroethyl)carbazol-3-yl]-5-methoxy-1,5-dioxopentan-2-ylidene]amino] benzoate |
| SMILES | COC(=O)CC/C(=N/OC(=O)c1ccccc1)C(=O)c1ccc2c(c1)c1cc(C(=O)C3CCCCC3)ccc1n2CC(F)(F)F |
| InChI | InChI=1S/C34H31F3N2O6/c1-44-30(40)17-14-27(38-45-33(43)22-10-6-3-7-11-22)32(42)24-13-16-29-26(19-24)25-18-23(31(41)21-8-4-2-5-9-21)12-15-28(25)39(29)20-34(35,36)37/h3,6-7,10-13,15-16,18-19,21H,2,4-5,8-9,14,17,20H2,1H3/b38-27- |
| InChIKey | YCWQBUXJYBHLCW-SPKJYZRXSA-N |
| XLogP | 7.47 |
| TPSA | 104.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.62 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|