C36H24Cl2N4O6 — CID 172945139
N-(3-azidopropyl)-4,7-dichloro-3',6'-dihydroxy-1-oxo-2',7'-diphenylspiro[2-benzofuran-3,9'-xanthene]-5-carboxamide (PubChem CID 172945139) has the molecular formula C36H24Cl2N4O6 and a molecular weight of 679.52 g/mol. Its IUPAC name is N-(3-azidopropyl)-4,7-dichloro-3',6'-dihydroxy-1-oxo-2',7'-diphenylspiro[2-benzofuran-3,9'-xanthene]-5-carboxamide.
| Compound Name | N-(3-azidopropyl)-4,7-dichloro-3',6'-dihydroxy-1-oxo-2',7'-diphenylspiro[2-benzofuran-3,9'-xanthene]-5-carboxamide |
|---|---|
| PubChem CID | 172945139 |
| Molecular Formula | C36H24Cl2N4O6 |
| Molecular Weight | 679.52 g/mol |
| Exact Mass | 678.11 |
| IUPAC Name | N-(3-azidopropyl)-4,7-dichloro-3',6'-dihydroxy-1-oxo-2',7'-diphenylspiro[2-benzofuran-3,9'-xanthene]-5-carboxamide |
| SMILES | [N-]=[N+]=NCCCNC(=O)c1cc(Cl)c2c(c1Cl)C1(OC2=O)c2cc(-c3ccccc3)c(O)cc2Oc2cc(O)c(-c3ccccc3)cc21 |
| InChI | InChI=1S/C36H24Cl2N4O6/c37-26-16-23(34(45)40-12-7-13-41-42-39)33(38)32-31(26)35(46)48-36(32)24-14-21(19-8-3-1-4-9-19)27(43)17-29(24)47-30-18-28(44)22(15-25(30)36)20-10-5-2-6-11-20/h1-6,8-11,14-18,43-44H,7,12-13H2,(H,40,45) |
| InChIKey | ZLAJZGXBYPQRHA-UHFFFAOYSA-N |
| XLogP | 8.74 |
| TPSA | 153.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.52 |
| LogP ≤ 5 | 8.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|