C31H30B2Cl3N5O10S2 — CID 172945692
CID 172945692 (PubChem CID 172945692) has the molecular formula C31H30B2Cl3N5O10S2 and a molecular weight of 824.72 g/mol.
| Compound Name | CID 172945692 |
|---|---|
| PubChem CID | 172945692 |
| Molecular Formula | C31H30B2Cl3N5O10S2 |
| Molecular Weight | 824.72 g/mol |
| Exact Mass | 823.07 |
| IUPAC Name | — |
| SMILES | [B]OC(=O)C1=C(CCl)CS[C@@H]2[C@H](CC(=O)/C(=N\OC(CNC(=O)c3ccc(C)c(C)c3Cl)C(=O)O[B])c3nc(NC(=O)OC(C)(C)C)sc3Cl)C(=O)N12 |
| InChI | InChI=1S/C31H30B2Cl3N5O10S2/c1-12-6-7-15(19(35)13(12)2)24(43)37-10-18(27(45)49-32)51-40-20(21-23(36)53-29(38-21)39-30(47)48-31(3,4)5)17(42)8-16-25(44)41-22(28(46)50-33)14(9-34)11-52-26(16)41/h6-7,16,18,26H,8-11H2,1-5H3,(H,37,43)(H,38,39,47)/b40-20+/t16-,18?,26-/m1/s1 |
| InChIKey | VNEQOSYXSFYWOI-BBMOEWKDSA-N |
| XLogP | 4.17 |
| TPSA | 191.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 824.72 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|