C28H35NO6Si — CID 172946041
10-O-propyl 9-O-(2-trimethylsilylethyl) (1R,11E)-4-hydroxy-11-phenoxyiminotricyclo[6.2.2.02,7]dodeca-2(7),3,5-triene-9,10-dicarboxylate (PubChem CID 172946041) has the molecular formula C28H35NO6Si and a molecular weight of 509.68 g/mol. Its IUPAC name is 10-O-propyl 9-O-(2-trimethylsilylethyl) (1R,11E)-4-hydroxy-11-phenoxyiminotricyclo[6.2.2.02,7]dodeca-2(7),3,5-triene-9,10-dicarboxylate.
| Compound Name | 10-O-propyl 9-O-(2-trimethylsilylethyl) (1R,11E)-4-hydroxy-11-phenoxyiminotricyclo[6.2.2.02,7]dodeca-2(7),3,5-triene-9,10-dicarboxylate |
|---|---|
| PubChem CID | 172946041 |
| Molecular Formula | C28H35NO6Si |
| Molecular Weight | 509.68 g/mol |
| Exact Mass | 509.22 |
| IUPAC Name | 10-O-propyl 9-O-(2-trimethylsilylethyl) (1R,11E)-4-hydroxy-11-phenoxyiminotricyclo[6.2.2.02,7]dodeca-2(7),3,5-triene-9,10-dicarboxylate |
| SMILES | CCCOC(=O)C1C(C(=O)OCC[Si](C)(C)C)C2C/C(=N\Oc3ccccc3)[C@H]1c1cc(O)ccc12 |
| InChI | InChI=1S/C28H35NO6Si/c1-5-13-33-28(32)26-24-21-16-18(30)11-12-20(21)22(25(26)27(31)34-14-15-36(2,3)4)17-23(24)29-35-19-9-7-6-8-10-19/h6-12,16,22,24-26,30H,5,13-15,17H2,1-4H3/b29-23+/t22?,24-,25?,26?/m1/s1 |
| InChIKey | GNDDTRQWAHTCQV-XYNSCDOYSA-N |
| XLogP | 5.48 |
| TPSA | 94.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.68 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|