C12H8ClF6NO — CID 172946967
(E)-1-(4-chlorophenyl)-N-[(E)-1,1,1,4,4,4-hexafluorobut-2-en-2-yl]oxyethanimine (PubChem CID 172946967) has the molecular formula C12H8ClF6NO and a molecular weight of 331.64 g/mol. Its IUPAC name is (E)-1-(4-chlorophenyl)-N-[(E)-1,1,1,4,4,4-hexafluorobut-2-en-2-yl]oxyethanimine.
| Compound Name | (E)-1-(4-chlorophenyl)-N-[(E)-1,1,1,4,4,4-hexafluorobut-2-en-2-yl]oxyethanimine |
|---|---|
| PubChem CID | 172946967 |
| Molecular Formula | C12H8ClF6NO |
| Molecular Weight | 331.64 g/mol |
| Exact Mass | 331.02 |
| IUPAC Name | (E)-1-(4-chlorophenyl)-N-[(E)-1,1,1,4,4,4-hexafluorobut-2-en-2-yl]oxyethanimine |
| SMILES | C/C(=N\O/C(=C/C(F)(F)F)C(F)(F)F)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C12H8ClF6NO/c1-7(8-2-4-9(13)5-3-8)20-21-10(12(17,18)19)6-11(14,15)16/h2-6H,1H3/b10-6+,20-7+ |
| InChIKey | WKYPWHWQUGNRTP-VIJYEEGDSA-N |
| XLogP | 5.09 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.64 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|