About aminourea;[(Z)-1-chloropropan-2-ylideneamino]urea
aminourea;[(Z)-1-chloropropan-2-ylideneamino]urea (PubChem CID 172947749) has the molecular formula C5H13ClN6O2
and a molecular weight of 224.65 g/mol. Its IUPAC name is aminourea;[(Z)-1-chloropropan-2-ylideneamino]urea.
Molecular Properties
| Compound Name | aminourea;[(Z)-1-chloropropan-2-ylideneamino]urea |
| PubChem CID | 172947749 |
| Molecular Formula | C5H13ClN6O2 |
| Molecular Weight | 224.65 g/mol |
| Exact Mass | 224.08 |
| IUPAC Name | aminourea;[(Z)-1-chloropropan-2-ylideneamino]urea |
| SMILES | C/C(CCl)=N/NC(N)=O.NNC(N)=O |
| InChI | InChI=1S/C4H8ClN3O.CH5N3O/c1-3(2-5)7-8-4(6)9;2-1(5)4-3/h2H2,1H3,(H3,6,8,9);3H2,(H3,2,4,5)/b7-3-; |
| InChIKey | IHEIORVNWNFZPO-WYLUAFJRSA-N |
| XLogP | -1.20 |
| TPSA | 148.62 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.65 |
| LogP ≤ 5 | -1.20 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze aminourea;[(Z)-1-chloropropan-2-ylideneamino]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of aminourea;[(Z)-1-chloropropan-2-ylideneamino]urea?
The IUPAC name of aminourea;[(Z)-1-chloropropan-2-ylideneamino]urea (CID 172947749) is aminourea;[(Z)-1-chloropropan-2-ylideneamino]urea.
What is the SMILES notation for aminourea;[(Z)-1-chloropropan-2-ylideneamino]urea?
The canonical SMILES for aminourea;[(Z)-1-chloropropan-2-ylideneamino]urea is C/C(CCl)=N/NC(N)=O.NNC(N)=O.
What is the InChIKey of aminourea;[(Z)-1-chloropropan-2-ylideneamino]urea?
The InChIKey is IHEIORVNWNFZPO-WYLUAFJRSA-N. The full InChI is InChI=1S/C4H8ClN3O.CH5N3O/c1-3(2-5)7-8-4(6)9;2-1(5)4-3/h2H2,1H3,(H3,6,8,9);3H2,(H3,2,4,5)/b7-3-;.
What are the key properties of aminourea;[(Z)-1-chloropropan-2-ylideneamino]urea?
aminourea;[(Z)-1-chloropropan-2-ylideneamino]urea has a molecular weight of 224.65 g/mol, XLogP of -1.20, 2 rotatable bonds, 5 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for aminourea;[(Z)-1-chloropropan-2-ylideneamino]urea is sourced from PubChem (CID 172947749), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).