C26H41N3O10 — CID 172948584
3-[2-[2-[2-[2-[(2-aminooxyacetyl)amino]ethoxy]ethoxy]ethoxy]ethoxy]-N-[1,3-bis(prop-2-ynoxy)-2-(prop-2-ynoxymethyl)propan-2-yl]propanamide (PubChem CID 172948584) has the molecular formula C26H41N3O10 and a molecular weight of 555.63 g/mol. Its IUPAC name is 3-[2-[2-[2-[2-[(2-aminooxyacetyl)amino]ethoxy]ethoxy]ethoxy]ethoxy]-N-[1,3-bis(prop-2-ynoxy)-2-(prop-2-ynoxymethyl)propan-2-yl]propanamide.
| Compound Name | 3-[2-[2-[2-[2-[(2-aminooxyacetyl)amino]ethoxy]ethoxy]ethoxy]ethoxy]-N-[1,3-bis(prop-2-ynoxy)-2-(prop-2-ynoxymethyl)propan-2-yl]propanamide |
|---|---|
| PubChem CID | 172948584 |
| Molecular Formula | C26H41N3O10 |
| Molecular Weight | 555.63 g/mol |
| Exact Mass | 555.28 |
| IUPAC Name | 3-[2-[2-[2-[2-[(2-aminooxyacetyl)amino]ethoxy]ethoxy]ethoxy]ethoxy]-N-[1,3-bis(prop-2-ynoxy)-2-(prop-2-ynoxymethyl)propan-2-yl]propanamide |
| SMILES | C#CCOCC(COCC#C)(COCC#C)NC(=O)CCOCCOCCOCCOCCNC(=O)CON |
| InChI | InChI=1S/C26H41N3O10/c1-4-9-36-21-26(22-37-10-5-2,23-38-11-6-3)29-24(30)7-12-32-14-16-34-18-19-35-17-15-33-13-8-28-25(31)20-39-27/h1-3H,7-23,27H2,(H,28,31)(H,29,30) |
| InChIKey | BYEVRUUXRVQBQR-UHFFFAOYSA-N |
| XLogP | -1.75 |
| TPSA | 158.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.63 |
| LogP ≤ 5 | -1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|