C12H12ClF6N3O — CID 172948954
4-[bis(2,2,2-trifluoroethyl)amino]-2-chloro-N'-hydroxy-3-methylbenzenecarboximidamide (PubChem CID 172948954) has the molecular formula C12H12ClF6N3O and a molecular weight of 363.69 g/mol. Its IUPAC name is 4-[bis(2,2,2-trifluoroethyl)amino]-2-chloro-N'-hydroxy-3-methylbenzenecarboximidamide.
| Compound Name | 4-[bis(2,2,2-trifluoroethyl)amino]-2-chloro-N'-hydroxy-3-methylbenzenecarboximidamide |
|---|---|
| PubChem CID | 172948954 |
| Molecular Formula | C12H12ClF6N3O |
| Molecular Weight | 363.69 g/mol |
| Exact Mass | 363.06 |
| IUPAC Name | 4-[bis(2,2,2-trifluoroethyl)amino]-2-chloro-N'-hydroxy-3-methylbenzenecarboximidamide |
| SMILES | Cc1c(N(CC(F)(F)F)CC(F)(F)F)ccc(/C(N)=N/O)c1Cl |
| InChI | InChI=1S/C12H12ClF6N3O/c1-6-8(3-2-7(9(6)13)10(20)21-23)22(4-11(14,15)16)5-12(17,18)19/h2-3,23H,4-5H2,1H3,(H2,20,21) |
| InChIKey | WIIZEYUBFNUNTP-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 61.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.69 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|