About CID 172949223
CID 172949223 (PubChem CID 172949223) has the molecular formula C9H17BN3
and a molecular weight of 178.07 g/mol.
Molecular Properties
| Compound Name | CID 172949223 |
| PubChem CID | 172949223 |
| Molecular Formula | C9H17BN3 |
| Molecular Weight | 178.07 g/mol |
| Exact Mass | 178.15 |
| IUPAC Name | — |
| SMILES | C/C(N)=N/N=C1/CCC[C@H](C)C1.[B] |
| InChI | InChI=1S/C9H17N3.B/c1-7-4-3-5-9(6-7)12-11-8(2)10;/h7H,3-6H2,1-2H3,(H2,10,11);/b12-9-;/t7-;/m0./s1 |
| InChIKey | SKHLGAXWHWFTDQ-QJZQYLQYSA-N |
| XLogP | 1.55 |
| TPSA | 50.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.07 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze CID 172949223 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 172949223?
The IUPAC name of CID 172949223 (CID 172949223) is not available.
What is the SMILES notation for CID 172949223?
The canonical SMILES for CID 172949223 is C/C(N)=N/N=C1/CCC[C@H](C)C1.[B].
What is the InChIKey of CID 172949223?
The InChIKey is SKHLGAXWHWFTDQ-QJZQYLQYSA-N. The full InChI is InChI=1S/C9H17N3.B/c1-7-4-3-5-9(6-7)12-11-8(2)10;/h7H,3-6H2,1-2H3,(H2,10,11);/b12-9-;/t7-;/m0./s1.
What are the key properties of CID 172949223?
CID 172949223 has a molecular weight of 178.07 g/mol, XLogP of 1.55, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 172949223 is sourced from PubChem (CID 172949223), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).