About CID 172949662
CID 172949662 (PubChem CID 172949662) has the molecular formula C23H32IN4O3-
and a molecular weight of 539.44 g/mol.
Molecular Properties
| Compound Name | CID 172949662 |
| PubChem CID | 172949662 |
| Molecular Formula | C23H32IN4O3- |
| Molecular Weight | 539.44 g/mol |
| Exact Mass | 539.15 |
| IUPAC Name | — |
| SMILES | Cc1nn(C)c(N2CCC[I-]CC2)c1/C=N/OCc1ccc(C(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C23H32IN4O3/c1-17-20(21(27(5)26-17)28-13-6-11-24-12-14-28)15-25-30-16-18-7-9-19(10-8-18)22(29)31-23(2,3)4/h7-10,15H,6,11-14,16H2,1-5H3/q-1/b25-15+ |
| InChIKey | VUNAQUMRLVIYPW-MFKUBSTISA-N |
| XLogP | 0.53 |
| TPSA | 68.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 539.44 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze CID 172949662 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 172949662?
The IUPAC name of CID 172949662 (CID 172949662) is not available.
What is the SMILES notation for CID 172949662?
The canonical SMILES for CID 172949662 is Cc1nn(C)c(N2CCC[I-]CC2)c1/C=N/OCc1ccc(C(=O)OC(C)(C)C)cc1.
What is the InChIKey of CID 172949662?
The InChIKey is VUNAQUMRLVIYPW-MFKUBSTISA-N. The full InChI is InChI=1S/C23H32IN4O3/c1-17-20(21(27(5)26-17)28-13-6-11-24-12-14-28)15-25-30-16-18-7-9-19(10-8-18)22(29)31-23(2,3)4/h7-10,15H,6,11-14,16H2,1-5H3/q-1/b25-15+.
What are the key properties of CID 172949662?
CID 172949662 has a molecular weight of 539.44 g/mol, XLogP of 0.53, 6 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for CID 172949662 is sourced from PubChem (CID 172949662), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).