About acetonitrile;N'-hydroxyethanimidamide;hydroxylamine
acetonitrile;N'-hydroxyethanimidamide;hydroxylamine (PubChem CID 172949722) has the molecular formula C4H12N4O2
and a molecular weight of 148.17 g/mol. Its IUPAC name is acetonitrile;N'-hydroxyethanimidamide;hydroxylamine.
Molecular Properties
| Compound Name | acetonitrile;N'-hydroxyethanimidamide;hydroxylamine |
| PubChem CID | 172949722 |
| Molecular Formula | C4H12N4O2 |
| Molecular Weight | 148.17 g/mol |
| Exact Mass | 148.10 |
| IUPAC Name | acetonitrile;N'-hydroxyethanimidamide;hydroxylamine |
| SMILES | C/C(N)=N/O.CC#N.NO |
| InChI | InChI=1S/C2H6N2O.C2H3N.H3NO/c1-2(3)4-5;1-2-3;1-2/h5H,1H3,(H2,3,4);1H3;2H,1H2 |
| InChIKey | GLALANWDUYKBGV-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 128.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.17 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze acetonitrile;N'-hydroxyethanimidamide;hydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetonitrile;N'-hydroxyethanimidamide;hydroxylamine?
The IUPAC name of acetonitrile;N'-hydroxyethanimidamide;hydroxylamine (CID 172949722) is acetonitrile;N'-hydroxyethanimidamide;hydroxylamine.
What is the SMILES notation for acetonitrile;N'-hydroxyethanimidamide;hydroxylamine?
The canonical SMILES for acetonitrile;N'-hydroxyethanimidamide;hydroxylamine is C/C(N)=N/O.CC#N.NO.
What is the InChIKey of acetonitrile;N'-hydroxyethanimidamide;hydroxylamine?
The InChIKey is GLALANWDUYKBGV-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H6N2O.C2H3N.H3NO/c1-2(3)4-5;1-2-3;1-2/h5H,1H3,(H2,3,4);1H3;2H,1H2.
What are the key properties of acetonitrile;N'-hydroxyethanimidamide;hydroxylamine?
acetonitrile;N'-hydroxyethanimidamide;hydroxylamine has a molecular weight of 148.17 g/mol, XLogP of -0.38, 0 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for acetonitrile;N'-hydroxyethanimidamide;hydroxylamine is sourced from PubChem (CID 172949722), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).