C18H26Cl2N2O — CID 17295026
N-methyl-N'-[(3-phenylmethoxyphenyl)methyl]propane-1,3-diamine;dihydrochloride (PubChem CID 17295026) has the molecular formula C18H26Cl2N2O and a molecular weight of 357.33 g/mol. Its IUPAC name is N-methyl-N'-[(3-phenylmethoxyphenyl)methyl]propane-1,3-diamine;dihydrochloride.
| Compound Name | N-methyl-N'-[(3-phenylmethoxyphenyl)methyl]propane-1,3-diamine;dihydrochloride |
|---|---|
| PubChem CID | 17295026 |
| Molecular Formula | C18H26Cl2N2O |
| Molecular Weight | 357.33 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | N-methyl-N'-[(3-phenylmethoxyphenyl)methyl]propane-1,3-diamine;dihydrochloride |
| SMILES | CNCCCNCc1cccc(OCc2ccccc2)c1.Cl.Cl |
| InChI | InChI=1S/C18H24N2O.2ClH/c1-19-11-6-12-20-14-17-9-5-10-18(13-17)21-15-16-7-3-2-4-8-16;;/h2-5,7-10,13,19-20H,6,11-12,14-15H2,1H3;2*1H |
| InChIKey | GEINHMPCALAKAW-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.33 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|