C12H19N3O2S — CID 172950866
ethyl (2S,3Z)-3-[(2,5-dimethyl-1,3-thiazol-4-yl)methylhydrazinylidene]-2-methylpropanoate (PubChem CID 172950866) has the molecular formula C12H19N3O2S and a molecular weight of 269.37 g/mol. Its IUPAC name is ethyl (2S,3Z)-3-[(2,5-dimethyl-1,3-thiazol-4-yl)methylhydrazinylidene]-2-methylpropanoate.
| Compound Name | ethyl (2S,3Z)-3-[(2,5-dimethyl-1,3-thiazol-4-yl)methylhydrazinylidene]-2-methylpropanoate |
|---|---|
| PubChem CID | 172950866 |
| Molecular Formula | C12H19N3O2S |
| Molecular Weight | 269.37 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | ethyl (2S,3Z)-3-[(2,5-dimethyl-1,3-thiazol-4-yl)methylhydrazinylidene]-2-methylpropanoate |
| SMILES | CCOC(=O)[C@@H](C)/C=N\NCc1nc(C)sc1C |
| InChI | InChI=1S/C12H19N3O2S/c1-5-17-12(16)8(2)6-13-14-7-11-9(3)18-10(4)15-11/h6,8,14H,5,7H2,1-4H3/b13-6-/t8-/m0/s1 |
| InChIKey | ASQBVHSIGHLWCN-BYODANBRSA-N |
| XLogP | 2.03 |
| TPSA | 63.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.37 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|