About 4-(2-formylphenyl)but-3-yn-2-yl acetate;4-[2-[(E)-hydroxyiminomethyl]phenyl]but-3-yn-2-yl acetate
4-(2-formylphenyl)but-3-yn-2-yl acetate;4-[2-[(E)-hydroxyiminomethyl]phenyl]but-3-yn-2-yl acetate (PubChem CID 172952429) has the molecular formula C26H25NO6
and a molecular weight of 447.49 g/mol. Its IUPAC name is 4-(2-formylphenyl)but-3-yn-2-yl acetate;4-[2-[(E)-hydroxyiminomethyl]phenyl]but-3-yn-2-yl acetate.
Molecular Properties
| Compound Name | 4-(2-formylphenyl)but-3-yn-2-yl acetate;4-[2-[(E)-hydroxyiminomethyl]phenyl]but-3-yn-2-yl acetate |
| PubChem CID | 172952429 |
| Molecular Formula | C26H25NO6 |
| Molecular Weight | 447.49 g/mol |
| Exact Mass | 447.17 |
| IUPAC Name | 4-(2-formylphenyl)but-3-yn-2-yl acetate;4-[2-[(E)-hydroxyiminomethyl]phenyl]but-3-yn-2-yl acetate |
| SMILES | CC(=O)OC(C)C#Cc1ccccc1/C=N/O.CC(=O)OC(C)C#Cc1ccccc1C=O |
| InChI | InChI=1S/C13H13NO3.C13H12O3/c1-10(17-11(2)15)7-8-12-5-3-4-6-13(12)9-14-16;1-10(16-11(2)15)7-8-12-5-3-4-6-13(12)9-14/h3-6,9-10,16H,1-2H3;3-6,9-10H,1-2H3/b14-9+; |
| InChIKey | KKMZPUUDJWBFIP-KYIGKLDSSA-N |
| XLogP | 3.60 |
| TPSA | 102.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 447.49 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-(2-formylphenyl)but-3-yn-2-yl acetate;4-[2-[(E)-hydroxyiminomethyl]phenyl]but-3-yn-2-yl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-formylphenyl)but-3-yn-2-yl acetate;4-[2-[(E)-hydroxyiminomethyl]phenyl]but-3-yn-2-yl acetate?
The IUPAC name of 4-(2-formylphenyl)but-3-yn-2-yl acetate;4-[2-[(E)-hydroxyiminomethyl]phenyl]but-3-yn-2-yl acetate (CID 172952429) is 4-(2-formylphenyl)but-3-yn-2-yl acetate;4-[2-[(E)-hydroxyiminomethyl]phenyl]but-3-yn-2-yl acetate.
What is the SMILES notation for 4-(2-formylphenyl)but-3-yn-2-yl acetate;4-[2-[(E)-hydroxyiminomethyl]phenyl]but-3-yn-2-yl acetate?
The canonical SMILES for 4-(2-formylphenyl)but-3-yn-2-yl acetate;4-[2-[(E)-hydroxyiminomethyl]phenyl]but-3-yn-2-yl acetate is CC(=O)OC(C)C#Cc1ccccc1/C=N/O.CC(=O)OC(C)C#Cc1ccccc1C=O.
What is the InChIKey of 4-(2-formylphenyl)but-3-yn-2-yl acetate;4-[2-[(E)-hydroxyiminomethyl]phenyl]but-3-yn-2-yl acetate?
The InChIKey is KKMZPUUDJWBFIP-KYIGKLDSSA-N. The full InChI is InChI=1S/C13H13NO3.C13H12O3/c1-10(17-11(2)15)7-8-12-5-3-4-6-13(12)9-14-16;1-10(16-11(2)15)7-8-12-5-3-4-6-13(12)9-14/h3-6,9-10,16H,1-2H3;3-6,9-10H,1-2H3/b14-9+;.
What are the key properties of 4-(2-formylphenyl)but-3-yn-2-yl acetate;4-[2-[(E)-hydroxyiminomethyl]phenyl]but-3-yn-2-yl acetate?
4-(2-formylphenyl)but-3-yn-2-yl acetate;4-[2-[(E)-hydroxyiminomethyl]phenyl]but-3-yn-2-yl acetate has a molecular weight of 447.49 g/mol, XLogP of 3.60, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-formylphenyl)but-3-yn-2-yl acetate;4-[2-[(E)-hydroxyiminomethyl]phenyl]but-3-yn-2-yl acetate is sourced from PubChem (CID 172952429), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).