C19H19Cl2N3O4 — CID 172952899
(1S,2R,3R,5R)-3-[(S)-(3,4-dichlorophenyl)-hydroxymethyl]-5-[(4E)-4-hydroxyimino-7H-pyrrolo[3,2-c]pyridin-1-yl]cyclopentane-1,2-diol (PubChem CID 172952899) has the molecular formula C19H19Cl2N3O4 and a molecular weight of 424.28 g/mol. Its IUPAC name is (1S,2R,3R,5R)-3-[(S)-(3,4-dichlorophenyl)-hydroxymethyl]-5-[(4E)-4-hydroxyimino-7H-pyrrolo[3,2-c]pyridin-1-yl]cyclopentane-1,2-diol.
| Compound Name | (1S,2R,3R,5R)-3-[(S)-(3,4-dichlorophenyl)-hydroxymethyl]-5-[(4E)-4-hydroxyimino-7H-pyrrolo[3,2-c]pyridin-1-yl]cyclopentane-1,2-diol |
|---|---|
| PubChem CID | 172952899 |
| Molecular Formula | C19H19Cl2N3O4 |
| Molecular Weight | 424.28 g/mol |
| Exact Mass | 423.08 |
| IUPAC Name | (1S,2R,3R,5R)-3-[(S)-(3,4-dichlorophenyl)-hydroxymethyl]-5-[(4E)-4-hydroxyimino-7H-pyrrolo[3,2-c]pyridin-1-yl]cyclopentane-1,2-diol |
| SMILES | O/N=C1/N=CCc2c1ccn2[C@@H]1C[C@H]([C@H](O)c2ccc(Cl)c(Cl)c2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C19H19Cl2N3O4/c20-12-2-1-9(7-13(12)21)16(25)11-8-15(18(27)17(11)26)24-6-4-10-14(24)3-5-22-19(10)23-28/h1-2,4-7,11,15-18,25-28H,3,8H2/b23-19+/t11-,15-,16-,17-,18+/m1/s1 |
| InChIKey | HWQIMNGZOIOKTC-QPGXPZGFSA-N |
| XLogP | 2.57 |
| TPSA | 110.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.28 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|