C20H24N2O5S — CID 172953032
[(Z)-[cyano-(4-methoxyphenyl)methylidene]amino] (9,9-dimethyl-3-oxatricyclo[4.2.1.02,5]nonan-1-yl)methanesulfonate (PubChem CID 172953032) has the molecular formula C20H24N2O5S and a molecular weight of 404.49 g/mol. Its IUPAC name is [(Z)-[cyano-(4-methoxyphenyl)methylidene]amino] (9,9-dimethyl-3-oxatricyclo[4.2.1.02,5]nonan-1-yl)methanesulfonate.
| Compound Name | [(Z)-[cyano-(4-methoxyphenyl)methylidene]amino] (9,9-dimethyl-3-oxatricyclo[4.2.1.02,5]nonan-1-yl)methanesulfonate |
|---|---|
| PubChem CID | 172953032 |
| Molecular Formula | C20H24N2O5S |
| Molecular Weight | 404.49 g/mol |
| Exact Mass | 404.14 |
| IUPAC Name | [(Z)-[cyano-(4-methoxyphenyl)methylidene]amino] (9,9-dimethyl-3-oxatricyclo[4.2.1.02,5]nonan-1-yl)methanesulfonate |
| SMILES | COc1ccc(/C(C#N)=N/OS(=O)(=O)CC23CCC(C4COC42)C3(C)C)cc1 |
| InChI | InChI=1S/C20H24N2O5S/c1-19(2)16-8-9-20(19,18-15(16)11-26-18)12-28(23,24)27-22-17(10-21)13-4-6-14(25-3)7-5-13/h4-7,15-16,18H,8-9,11-12H2,1-3H3/b22-17+ |
| InChIKey | KQIULYKGODGIHO-OQKWZONESA-N |
| XLogP | 2.72 |
| TPSA | 97.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.49 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|