C6H11NOS — CID 172953084
(NZ)-N-(4,4-dimethylthiolan-3-ylidene)hydroxylamine (PubChem CID 172953084) has the molecular formula C6H11NOS and a molecular weight of 145.23 g/mol. Its IUPAC name is (NZ)-N-(4,4-dimethylthiolan-3-ylidene)hydroxylamine.
| Compound Name | (NZ)-N-(4,4-dimethylthiolan-3-ylidene)hydroxylamine |
|---|---|
| PubChem CID | 172953084 |
| Molecular Formula | C6H11NOS |
| Molecular Weight | 145.23 g/mol |
| Exact Mass | 145.06 |
| IUPAC Name | (NZ)-N-(4,4-dimethylthiolan-3-ylidene)hydroxylamine |
| SMILES | CC1(C)CSC/C1=N\O |
| InChI | InChI=1S/C6H11NOS/c1-6(2)4-9-3-5(6)7-8/h8H,3-4H2,1-2H3/b7-5+ |
| InChIKey | KUGUEICQHRGIMB-FNORWQNLSA-N |
| XLogP | 1.59 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.23 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|