C15H24Cl2N2 — CID 17295622
N',N'-diethyl-N-(3-phenylprop-2-ynyl)ethane-1,2-diamine;dihydrochloride (PubChem CID 17295622) has the molecular formula C15H24Cl2N2 and a molecular weight of 303.28 g/mol. Its IUPAC name is N',N'-diethyl-N-(3-phenylprop-2-ynyl)ethane-1,2-diamine;dihydrochloride.
| Compound Name | N',N'-diethyl-N-(3-phenylprop-2-ynyl)ethane-1,2-diamine;dihydrochloride |
|---|---|
| PubChem CID | 17295622 |
| Molecular Formula | C15H24Cl2N2 |
| Molecular Weight | 303.28 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | N',N'-diethyl-N-(3-phenylprop-2-ynyl)ethane-1,2-diamine;dihydrochloride |
| SMILES | CCN(CC)CCNCC#Cc1ccccc1.Cl.Cl |
| InChI | InChI=1S/C15H22N2.2ClH/c1-3-17(4-2)14-13-16-12-8-11-15-9-6-5-7-10-15;;/h5-7,9-10,16H,3-4,12-14H2,1-2H3;2*1H |
| InChIKey | CUJMSLLRSOLXFC-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.28 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|