C28H41N3O6S — CID 172956654
N-[(1R)-1-[4-(cyclopropylmethoxy)-6-oxopyran-2-yl]butyl]-2-[(E)-N-[2-(5,5-dimethyloxolan-2-yl)ethoxy]-C-methylcarbonimidoyl]-4-methyl-5H-1,3-thiazole-4-carboxamide (PubChem CID 172956654) has the molecular formula C28H41N3O6S and a molecular weight of 547.72 g/mol. Its IUPAC name is N-[(1R)-1-[4-(cyclopropylmethoxy)-6-oxopyran-2-yl]butyl]-2-[(E)-N-[2-(5,5-dimethyloxolan-2-yl)ethoxy]-C-methylcarbonimidoyl]-4-methyl-5H-1,3-thiazole-4-carboxamide.
| Compound Name | N-[(1R)-1-[4-(cyclopropylmethoxy)-6-oxopyran-2-yl]butyl]-2-[(E)-N-[2-(5,5-dimethyloxolan-2-yl)ethoxy]-C-methylcarbonimidoyl]-4-methyl-5H-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 172956654 |
| Molecular Formula | C28H41N3O6S |
| Molecular Weight | 547.72 g/mol |
| Exact Mass | 547.27 |
| IUPAC Name | N-[(1R)-1-[4-(cyclopropylmethoxy)-6-oxopyran-2-yl]butyl]-2-[(E)-N-[2-(5,5-dimethyloxolan-2-yl)ethoxy]-C-methylcarbonimidoyl]-4-methyl-5H-1,3-thiazole-4-carboxamide |
| SMILES | CCC[C@@H](NC(=O)C1(C)CSC(/C(C)=N/OCCC2CCC(C)(C)O2)=N1)c1cc(OCC2CC2)cc(=O)o1 |
| InChI | InChI=1S/C28H41N3O6S/c1-6-7-22(23-14-21(15-24(32)36-23)34-16-19-8-9-19)29-26(33)28(5)17-38-25(30-28)18(2)31-35-13-11-20-10-12-27(3,4)37-20/h14-15,19-20,22H,6-13,16-17H2,1-5H3,(H,29,33)/b31-18+/t20?,22-,28?/m1/s1 |
| InChIKey | GHGCJPUUKRGDSX-DOCFKRJWSA-N |
| XLogP | 5.03 |
| TPSA | 111.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.72 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|