About formic acid;N'-hydroxy-4-(4-hydroxyoxan-4-yl)benzenecarboximidamide
formic acid;N'-hydroxy-4-(4-hydroxyoxan-4-yl)benzenecarboximidamide (PubChem CID 172957539) has the molecular formula C13H18N2O5
and a molecular weight of 282.30 g/mol. Its IUPAC name is formic acid;N'-hydroxy-4-(4-hydroxyoxan-4-yl)benzenecarboximidamide.
Molecular Properties
| Compound Name | formic acid;N'-hydroxy-4-(4-hydroxyoxan-4-yl)benzenecarboximidamide |
| PubChem CID | 172957539 |
| Molecular Formula | C13H18N2O5 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | formic acid;N'-hydroxy-4-(4-hydroxyoxan-4-yl)benzenecarboximidamide |
| SMILES | N/C(=N\O)c1ccc(C2(O)CCOCC2)cc1.O=CO |
| InChI | InChI=1S/C12H16N2O3.CH2O2/c13-11(14-16)9-1-3-10(4-2-9)12(15)5-7-17-8-6-12;2-1-3/h1-4,15-16H,5-8H2,(H2,13,14);1H,(H,2,3) |
| InChIKey | BAAYCTRYIWQGPC-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 125.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze formic acid;N'-hydroxy-4-(4-hydroxyoxan-4-yl)benzenecarboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of formic acid;N'-hydroxy-4-(4-hydroxyoxan-4-yl)benzenecarboximidamide?
The IUPAC name of formic acid;N'-hydroxy-4-(4-hydroxyoxan-4-yl)benzenecarboximidamide (CID 172957539) is formic acid;N'-hydroxy-4-(4-hydroxyoxan-4-yl)benzenecarboximidamide.
What is the SMILES notation for formic acid;N'-hydroxy-4-(4-hydroxyoxan-4-yl)benzenecarboximidamide?
The canonical SMILES for formic acid;N'-hydroxy-4-(4-hydroxyoxan-4-yl)benzenecarboximidamide is N/C(=N\O)c1ccc(C2(O)CCOCC2)cc1.O=CO.
What is the InChIKey of formic acid;N'-hydroxy-4-(4-hydroxyoxan-4-yl)benzenecarboximidamide?
The InChIKey is BAAYCTRYIWQGPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N2O3.CH2O2/c13-11(14-16)9-1-3-10(4-2-9)12(15)5-7-17-8-6-12;2-1-3/h1-4,15-16H,5-8H2,(H2,13,14);1H,(H,2,3).
What are the key properties of formic acid;N'-hydroxy-4-(4-hydroxyoxan-4-yl)benzenecarboximidamide?
formic acid;N'-hydroxy-4-(4-hydroxyoxan-4-yl)benzenecarboximidamide has a molecular weight of 282.30 g/mol, XLogP of 0.48, 2 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for formic acid;N'-hydroxy-4-(4-hydroxyoxan-4-yl)benzenecarboximidamide is sourced from PubChem (CID 172957539), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).