C17H16BrClF5NO — CID 172959020
(E,2E,4R,6E)-4-bromo-8-chloro-3,7-dimethyl-N-[(2,3,4,5,6-pentafluorophenyl)methoxy]octa-2,6-dien-1-imine (PubChem CID 172959020) has the molecular formula C17H16BrClF5NO and a molecular weight of 460.67 g/mol. Its IUPAC name is (E,2E,4R,6E)-4-bromo-8-chloro-3,7-dimethyl-N-[(2,3,4,5,6-pentafluorophenyl)methoxy]octa-2,6-dien-1-imine.
| Compound Name | (E,2E,4R,6E)-4-bromo-8-chloro-3,7-dimethyl-N-[(2,3,4,5,6-pentafluorophenyl)methoxy]octa-2,6-dien-1-imine |
|---|---|
| PubChem CID | 172959020 |
| Molecular Formula | C17H16BrClF5NO |
| Molecular Weight | 460.67 g/mol |
| Exact Mass | 459.00 |
| IUPAC Name | (E,2E,4R,6E)-4-bromo-8-chloro-3,7-dimethyl-N-[(2,3,4,5,6-pentafluorophenyl)methoxy]octa-2,6-dien-1-imine |
| SMILES | C/C(=C\C[C@@H](Br)/C(C)=C/C=N/OCc1c(F)c(F)c(F)c(F)c1F)CCl |
| InChI | InChI=1S/C17H16BrClF5NO/c1-9(7-19)3-4-12(18)10(2)5-6-25-26-8-11-13(20)15(22)17(24)16(23)14(11)21/h3,5-6,12H,4,7-8H2,1-2H3/b9-3+,10-5+,25-6+/t12-/m1/s1 |
| InChIKey | GGQZERPDTYNYRD-QSMXSAABSA-N |
| XLogP | 6.17 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.67 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|