C25H33N5O — CID 172959597
2-[2-[[(Z)-[1-butyl-3-(2,4,6-trimethylphenyl)imidazol-2-ylidene]amino]diazenyl]phenyl]propan-2-ol (PubChem CID 172959597) has the molecular formula C25H33N5O and a molecular weight of 419.57 g/mol. Its IUPAC name is 2-[2-[[(Z)-[1-butyl-3-(2,4,6-trimethylphenyl)imidazol-2-ylidene]amino]diazenyl]phenyl]propan-2-ol.
| Compound Name | 2-[2-[[(Z)-[1-butyl-3-(2,4,6-trimethylphenyl)imidazol-2-ylidene]amino]diazenyl]phenyl]propan-2-ol |
|---|---|
| PubChem CID | 172959597 |
| Molecular Formula | C25H33N5O |
| Molecular Weight | 419.57 g/mol |
| Exact Mass | 419.27 |
| IUPAC Name | 2-[2-[[(Z)-[1-butyl-3-(2,4,6-trimethylphenyl)imidazol-2-ylidene]amino]diazenyl]phenyl]propan-2-ol |
| SMILES | CCCCn1ccn(-c2c(C)cc(C)cc2C)/c1=N\N=N/c1ccccc1C(C)(C)O |
| InChI | InChI=1S/C25H33N5O/c1-7-8-13-29-14-15-30(23-19(3)16-18(2)17-20(23)4)24(29)27-28-26-22-12-10-9-11-21(22)25(5,6)31/h9-12,14-17,31H,7-8,13H2,1-6H3/b27-24-,28-26- |
| InChIKey | ODRUKNYCFYDLJQ-OTYDTDFCSA-N |
| XLogP | 5.83 |
| TPSA | 67.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.57 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|