C16H15F3N4O3 — CID 172959956
2-hydroxy-N-[(Z)-[1,1,1-trifluoro-3-[3-(2-methylpyrazol-3-yl)oxiran-2-yl]propan-2-ylidene]amino]benzamide (PubChem CID 172959956) has the molecular formula C16H15F3N4O3 and a molecular weight of 368.32 g/mol. Its IUPAC name is 2-hydroxy-N-[(Z)-[1,1,1-trifluoro-3-[3-(2-methylpyrazol-3-yl)oxiran-2-yl]propan-2-ylidene]amino]benzamide.
| Compound Name | 2-hydroxy-N-[(Z)-[1,1,1-trifluoro-3-[3-(2-methylpyrazol-3-yl)oxiran-2-yl]propan-2-ylidene]amino]benzamide |
|---|---|
| PubChem CID | 172959956 |
| Molecular Formula | C16H15F3N4O3 |
| Molecular Weight | 368.32 g/mol |
| Exact Mass | 368.11 |
| IUPAC Name | 2-hydroxy-N-[(Z)-[1,1,1-trifluoro-3-[3-(2-methylpyrazol-3-yl)oxiran-2-yl]propan-2-ylidene]amino]benzamide |
| SMILES | Cn1nccc1C1OC1C/C(=N/NC(=O)c1ccccc1O)C(F)(F)F |
| InChI | InChI=1S/C16H15F3N4O3/c1-23-10(6-7-20-23)14-12(26-14)8-13(16(17,18)19)21-22-15(25)9-4-2-3-5-11(9)24/h2-7,12,14,24H,8H2,1H3,(H,22,25)/b21-13- |
| InChIKey | WRXPNIQWDLHPDV-BKUYFWCQSA-N |
| XLogP | 2.30 |
| TPSA | 92.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.32 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|