About 2-[(E)-(2,2-dimethyl-5-oxohexan-3-ylidene)amino]oxyacetic acid
2-[(E)-(2,2-dimethyl-5-oxohexan-3-ylidene)amino]oxyacetic acid (PubChem CID 172960190) has the molecular formula C10H17NO4
and a molecular weight of 215.25 g/mol. Its IUPAC name is 2-[(E)-(2,2-dimethyl-5-oxohexan-3-ylidene)amino]oxyacetic acid.
Molecular Properties
| Compound Name | 2-[(E)-(2,2-dimethyl-5-oxohexan-3-ylidene)amino]oxyacetic acid |
| PubChem CID | 172960190 |
| Molecular Formula | C10H17NO4 |
| Molecular Weight | 215.25 g/mol |
| Exact Mass | 215.12 |
| IUPAC Name | 2-[(E)-(2,2-dimethyl-5-oxohexan-3-ylidene)amino]oxyacetic acid |
| SMILES | CC(=O)C/C(=N\OCC(=O)O)C(C)(C)C |
| InChI | InChI=1S/C10H17NO4/c1-7(12)5-8(10(2,3)4)11-15-6-9(13)14/h5-6H2,1-4H3,(H,13,14)/b11-8+ |
| InChIKey | AHQPGVREVPQXCJ-DHZHZOJOSA-N |
| XLogP | 1.47 |
| TPSA | 75.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.25 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[(E)-(2,2-dimethyl-5-oxohexan-3-ylidene)amino]oxyacetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(E)-(2,2-dimethyl-5-oxohexan-3-ylidene)amino]oxyacetic acid?
The IUPAC name of 2-[(E)-(2,2-dimethyl-5-oxohexan-3-ylidene)amino]oxyacetic acid (CID 172960190) is 2-[(E)-(2,2-dimethyl-5-oxohexan-3-ylidene)amino]oxyacetic acid.
What is the SMILES notation for 2-[(E)-(2,2-dimethyl-5-oxohexan-3-ylidene)amino]oxyacetic acid?
The canonical SMILES for 2-[(E)-(2,2-dimethyl-5-oxohexan-3-ylidene)amino]oxyacetic acid is CC(=O)C/C(=N\OCC(=O)O)C(C)(C)C.
What is the InChIKey of 2-[(E)-(2,2-dimethyl-5-oxohexan-3-ylidene)amino]oxyacetic acid?
The InChIKey is AHQPGVREVPQXCJ-DHZHZOJOSA-N. The full InChI is InChI=1S/C10H17NO4/c1-7(12)5-8(10(2,3)4)11-15-6-9(13)14/h5-6H2,1-4H3,(H,13,14)/b11-8+.
What are the key properties of 2-[(E)-(2,2-dimethyl-5-oxohexan-3-ylidene)amino]oxyacetic acid?
2-[(E)-(2,2-dimethyl-5-oxohexan-3-ylidene)amino]oxyacetic acid has a molecular weight of 215.25 g/mol, XLogP of 1.47, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(E)-(2,2-dimethyl-5-oxohexan-3-ylidene)amino]oxyacetic acid is sourced from PubChem (CID 172960190), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).