C4H6Cl4N2O4 — CID 172960886
(1Z,2E)-N-hydroxy-2-hydroxyiminoethanimidoyl chloride;2,2,2-trichloroethane-1,1-diol (PubChem CID 172960886) has the molecular formula C4H6Cl4N2O4 and a molecular weight of 287.91 g/mol. Its IUPAC name is (1Z,2E)-N-hydroxy-2-hydroxyiminoethanimidoyl chloride;2,2,2-trichloroethane-1,1-diol.
| Compound Name | (1Z,2E)-N-hydroxy-2-hydroxyiminoethanimidoyl chloride;2,2,2-trichloroethane-1,1-diol |
|---|---|
| PubChem CID | 172960886 |
| Molecular Formula | C4H6Cl4N2O4 |
| Molecular Weight | 287.91 g/mol |
| Exact Mass | 285.91 |
| IUPAC Name | (1Z,2E)-N-hydroxy-2-hydroxyiminoethanimidoyl chloride;2,2,2-trichloroethane-1,1-diol |
| SMILES | O/N=C(Cl)/C=N/O.OC(O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C2H3Cl3O2.C2H3ClN2O2/c3-2(4,5)1(6)7;3-2(5-7)1-4-6/h2*1,6-7H/b;4-1+,5-2- |
| InChIKey | TXUTZLZLLIUYRK-HXVJKESSSA-N |
| XLogP | 1.14 |
| TPSA | 105.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.91 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|