C32H28N6O — CID 172961653
4-(2,4-dimethylphenyl)-1H-pyrrolo[2,3-b]pyridine-3-carbonitrile;(NE)-N-[[4-(2,4-dimethylphenyl)-1H-pyrrolo[2,3-b]pyridin-3-yl]methylidene]hydroxylamine (PubChem CID 172961653) has the molecular formula C32H28N6O and a molecular weight of 512.62 g/mol. Its IUPAC name is 4-(2,4-dimethylphenyl)-1H-pyrrolo[2,3-b]pyridine-3-carbonitrile;(NE)-N-[[4-(2,4-dimethylphenyl)-1H-pyrrolo[2,3-b]pyridin-3-yl]methylidene]hydroxylamine.
| Compound Name | 4-(2,4-dimethylphenyl)-1H-pyrrolo[2,3-b]pyridine-3-carbonitrile;(NE)-N-[[4-(2,4-dimethylphenyl)-1H-pyrrolo[2,3-b]pyridin-3-yl]methylidene]hydroxylamine |
|---|---|
| PubChem CID | 172961653 |
| Molecular Formula | C32H28N6O |
| Molecular Weight | 512.62 g/mol |
| Exact Mass | 512.23 |
| IUPAC Name | 4-(2,4-dimethylphenyl)-1H-pyrrolo[2,3-b]pyridine-3-carbonitrile;(NE)-N-[[4-(2,4-dimethylphenyl)-1H-pyrrolo[2,3-b]pyridin-3-yl]methylidene]hydroxylamine |
| SMILES | Cc1ccc(-c2ccnc3[nH]cc(/C=N/O)c23)c(C)c1.Cc1ccc(-c2ccnc3[nH]cc(C#N)c23)c(C)c1 |
| InChI | InChI=1S/C16H15N3O.C16H13N3/c1-10-3-4-13(11(2)7-10)14-5-6-17-16-15(14)12(8-18-16)9-19-20;1-10-3-4-13(11(2)7-10)14-5-6-18-16-15(14)12(8-17)9-19-16/h3-9,20H,1-2H3,(H,17,18);3-7,9H,1-2H3,(H,18,19)/b19-9+; |
| InChIKey | VXAZEIFZPHJFSG-MYHMWQFYSA-N |
| XLogP | 7.37 |
| TPSA | 113.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.62 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|