About (NE)-N-[1-(3-amino-1-oxido-1,2,4-benzotriazin-1-ium-7-yl)ethylidene]hydroxylamine;methane
(NE)-N-[1-(3-amino-1-oxido-1,2,4-benzotriazin-1-ium-7-yl)ethylidene]hydroxylamine;methane (PubChem CID 172962909) has the molecular formula C11H17N5O2
and a molecular weight of 251.29 g/mol. Its IUPAC name is (NE)-N-[1-(3-amino-1-oxido-1,2,4-benzotriazin-1-ium-7-yl)ethylidene]hydroxylamine;methane.
Molecular Properties
| Compound Name | (NE)-N-[1-(3-amino-1-oxido-1,2,4-benzotriazin-1-ium-7-yl)ethylidene]hydroxylamine;methane |
| PubChem CID | 172962909 |
| Molecular Formula | C11H17N5O2 |
| Molecular Weight | 251.29 g/mol |
| Exact Mass | 251.14 |
| IUPAC Name | (NE)-N-[1-(3-amino-1-oxido-1,2,4-benzotriazin-1-ium-7-yl)ethylidene]hydroxylamine;methane |
| SMILES | C.C.C/C(=N\O)c1ccc2nc(N)n[n+]([O-])c2c1 |
| InChI | InChI=1S/C9H9N5O2.2CH4/c1-5(13-15)6-2-3-7-8(4-6)14(16)12-9(10)11-7;;/h2-4,15H,1H3,(H2,10,11,12);2*1H4/b13-5+;; |
| InChIKey | ARHADZHXYWYTEQ-IXYGCXJQSA-N |
| XLogP | 1.32 |
| TPSA | 111.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.29 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze (NE)-N-[1-(3-amino-1-oxido-1,2,4-benzotriazin-1-ium-7-yl)ethylidene]hydroxylamine;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (NE)-N-[1-(3-amino-1-oxido-1,2,4-benzotriazin-1-ium-7-yl)ethylidene]hydroxylamine;methane?
The IUPAC name of (NE)-N-[1-(3-amino-1-oxido-1,2,4-benzotriazin-1-ium-7-yl)ethylidene]hydroxylamine;methane (CID 172962909) is (NE)-N-[1-(3-amino-1-oxido-1,2,4-benzotriazin-1-ium-7-yl)ethylidene]hydroxylamine;methane.
What is the SMILES notation for (NE)-N-[1-(3-amino-1-oxido-1,2,4-benzotriazin-1-ium-7-yl)ethylidene]hydroxylamine;methane?
The canonical SMILES for (NE)-N-[1-(3-amino-1-oxido-1,2,4-benzotriazin-1-ium-7-yl)ethylidene]hydroxylamine;methane is C.C.C/C(=N\O)c1ccc2nc(N)n[n+]([O-])c2c1.
What is the InChIKey of (NE)-N-[1-(3-amino-1-oxido-1,2,4-benzotriazin-1-ium-7-yl)ethylidene]hydroxylamine;methane?
The InChIKey is ARHADZHXYWYTEQ-IXYGCXJQSA-N. The full InChI is InChI=1S/C9H9N5O2.2CH4/c1-5(13-15)6-2-3-7-8(4-6)14(16)12-9(10)11-7;;/h2-4,15H,1H3,(H2,10,11,12);2*1H4/b13-5+;;.
What are the key properties of (NE)-N-[1-(3-amino-1-oxido-1,2,4-benzotriazin-1-ium-7-yl)ethylidene]hydroxylamine;methane?
(NE)-N-[1-(3-amino-1-oxido-1,2,4-benzotriazin-1-ium-7-yl)ethylidene]hydroxylamine;methane has a molecular weight of 251.29 g/mol, XLogP of 1.32, 1 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (NE)-N-[1-(3-amino-1-oxido-1,2,4-benzotriazin-1-ium-7-yl)ethylidene]hydroxylamine;methane is sourced from PubChem (CID 172962909), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).