C28H40N4O3 — CID 172964617
N-[(E)-(3-tert-butyl-2-hydroxy-5-propan-2-ylphenyl)methylideneamino]-2-[4-[(4-methoxyphenyl)methyl]piperazin-1-yl]acetamide (PubChem CID 172964617) has the molecular formula C28H40N4O3 and a molecular weight of 480.65 g/mol. Its IUPAC name is N-[(E)-(3-tert-butyl-2-hydroxy-5-propan-2-ylphenyl)methylideneamino]-2-[4-[(4-methoxyphenyl)methyl]piperazin-1-yl]acetamide.
| Compound Name | N-[(E)-(3-tert-butyl-2-hydroxy-5-propan-2-ylphenyl)methylideneamino]-2-[4-[(4-methoxyphenyl)methyl]piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 172964617 |
| Molecular Formula | C28H40N4O3 |
| Molecular Weight | 480.65 g/mol |
| Exact Mass | 480.31 |
| IUPAC Name | N-[(E)-(3-tert-butyl-2-hydroxy-5-propan-2-ylphenyl)methylideneamino]-2-[4-[(4-methoxyphenyl)methyl]piperazin-1-yl]acetamide |
| SMILES | COc1ccc(CN2CCN(CC(=O)N/N=C/c3cc(C(C)C)cc(C(C)(C)C)c3O)CC2)cc1 |
| InChI | InChI=1S/C28H40N4O3/c1-20(2)22-15-23(27(34)25(16-22)28(3,4)5)17-29-30-26(33)19-32-13-11-31(12-14-32)18-21-7-9-24(35-6)10-8-21/h7-10,15-17,20,34H,11-14,18-19H2,1-6H3,(H,30,33)/b29-17+ |
| InChIKey | MPSUBCCNKGMDHI-STBIYBPSSA-N |
| XLogP | 4.09 |
| TPSA | 77.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.65 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|