About 1-[2-[4-(2,3-dimethoxyphenyl)phenyl]-2-oxoethyl]-5-fluoropyrimidine-2,4-dione
1-[2-[4-(2,3-dimethoxyphenyl)phenyl]-2-oxoethyl]-5-fluoropyrimidine-2,4-dione (PubChem CID 172965222) has the molecular formula C20H17FN2O5
and a molecular weight of 384.36 g/mol. Its IUPAC name is 1-[2-[4-(2,3-dimethoxyphenyl)phenyl]-2-oxoethyl]-5-fluoropyrimidine-2,4-dione.
Molecular Properties
| Compound Name | 1-[2-[4-(2,3-dimethoxyphenyl)phenyl]-2-oxoethyl]-5-fluoropyrimidine-2,4-dione |
| PubChem CID | 172965222 |
| Molecular Formula | C20H17FN2O5 |
| Molecular Weight | 384.36 g/mol |
| Exact Mass | 384.11 |
| IUPAC Name | 1-[2-[4-(2,3-dimethoxyphenyl)phenyl]-2-oxoethyl]-5-fluoropyrimidine-2,4-dione |
| SMILES | COc1cccc(-c2ccc(C(=O)Cn3cc(F)c(=O)[nH]c3=O)cc2)c1OC |
| InChI | InChI=1S/C20H17FN2O5/c1-27-17-5-3-4-14(18(17)28-2)12-6-8-13(9-7-12)16(24)11-23-10-15(21)19(25)22-20(23)26/h3-10H,11H2,1-2H3,(H,22,25,26) |
| InChIKey | YIERQBNDLOGOFW-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.36 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-[2-[4-(2,3-dimethoxyphenyl)phenyl]-2-oxoethyl]-5-fluoropyrimidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-[4-(2,3-dimethoxyphenyl)phenyl]-2-oxoethyl]-5-fluoropyrimidine-2,4-dione?
The IUPAC name of 1-[2-[4-(2,3-dimethoxyphenyl)phenyl]-2-oxoethyl]-5-fluoropyrimidine-2,4-dione (CID 172965222) is 1-[2-[4-(2,3-dimethoxyphenyl)phenyl]-2-oxoethyl]-5-fluoropyrimidine-2,4-dione.
What is the SMILES notation for 1-[2-[4-(2,3-dimethoxyphenyl)phenyl]-2-oxoethyl]-5-fluoropyrimidine-2,4-dione?
The canonical SMILES for 1-[2-[4-(2,3-dimethoxyphenyl)phenyl]-2-oxoethyl]-5-fluoropyrimidine-2,4-dione is COc1cccc(-c2ccc(C(=O)Cn3cc(F)c(=O)[nH]c3=O)cc2)c1OC.
What is the InChIKey of 1-[2-[4-(2,3-dimethoxyphenyl)phenyl]-2-oxoethyl]-5-fluoropyrimidine-2,4-dione?
The InChIKey is YIERQBNDLOGOFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H17FN2O5/c1-27-17-5-3-4-14(18(17)28-2)12-6-8-13(9-7-12)16(24)11-23-10-15(21)19(25)22-20(23)26/h3-10H,11H2,1-2H3,(H,22,25,26).
What are the key properties of 1-[2-[4-(2,3-dimethoxyphenyl)phenyl]-2-oxoethyl]-5-fluoropyrimidine-2,4-dione?
1-[2-[4-(2,3-dimethoxyphenyl)phenyl]-2-oxoethyl]-5-fluoropyrimidine-2,4-dione has a molecular weight of 384.36 g/mol, XLogP of 2.24, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-[4-(2,3-dimethoxyphenyl)phenyl]-2-oxoethyl]-5-fluoropyrimidine-2,4-dione is sourced from PubChem (CID 172965222), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).