C13H21N3O — CID 172965576
[(Z)-1-[(1R,4R)-4,7,7-trimethyl-2-bicyclo[2.2.1]hept-2-enyl]ethylideneamino]urea (PubChem CID 172965576) has the molecular formula C13H21N3O and a molecular weight of 235.33 g/mol. Its IUPAC name is [(Z)-1-[(1R,4R)-4,7,7-trimethyl-2-bicyclo[2.2.1]hept-2-enyl]ethylideneamino]urea.
| Compound Name | [(Z)-1-[(1R,4R)-4,7,7-trimethyl-2-bicyclo[2.2.1]hept-2-enyl]ethylideneamino]urea |
|---|---|
| PubChem CID | 172965576 |
| Molecular Formula | C13H21N3O |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.17 |
| IUPAC Name | [(Z)-1-[(1R,4R)-4,7,7-trimethyl-2-bicyclo[2.2.1]hept-2-enyl]ethylideneamino]urea |
| SMILES | C/C(=N/NC(N)=O)C1=C[C@@]2(C)CC[C@@H]1C2(C)C |
| InChI | InChI=1S/C13H21N3O/c1-8(15-16-11(14)17)9-7-13(4)6-5-10(9)12(13,2)3/h7,10H,5-6H2,1-4H3,(H3,14,16,17)/b15-8-/t10-,13+/m0/s1 |
| InChIKey | MUWXGLGFBULXSQ-FLANYWFWSA-N |
| XLogP | 2.41 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|