C26H21FO7 — CID 172966232
[1-(1,4-dihydroxy-5,8-dioxonaphthalen-2-yl)-4-methylpent-3-enyl] (E)-4-(4-fluorophenyl)-4-oxobut-2-enoate (PubChem CID 172966232) has the molecular formula C26H21FO7 and a molecular weight of 464.45 g/mol. Its IUPAC name is [1-(1,4-dihydroxy-5,8-dioxonaphthalen-2-yl)-4-methylpent-3-enyl] (E)-4-(4-fluorophenyl)-4-oxobut-2-enoate.
| Compound Name | [1-(1,4-dihydroxy-5,8-dioxonaphthalen-2-yl)-4-methylpent-3-enyl] (E)-4-(4-fluorophenyl)-4-oxobut-2-enoate |
|---|---|
| PubChem CID | 172966232 |
| Molecular Formula | C26H21FO7 |
| Molecular Weight | 464.45 g/mol |
| Exact Mass | 464.13 |
| IUPAC Name | [1-(1,4-dihydroxy-5,8-dioxonaphthalen-2-yl)-4-methylpent-3-enyl] (E)-4-(4-fluorophenyl)-4-oxobut-2-enoate |
| SMILES | CC(C)=CCC(OC(=O)/C=C/C(=O)c1ccc(F)cc1)c1cc(O)c2c(c1O)C(=O)C=CC2=O |
| InChI | InChI=1S/C26H21FO7/c1-14(2)3-11-22(34-23(32)12-10-18(28)15-4-6-16(27)7-5-15)17-13-21(31)24-19(29)8-9-20(30)25(24)26(17)33/h3-10,12-13,22,31,33H,11H2,1-2H3/b12-10+ |
| InChIKey | XYCOURBAOXZTPR-ZRDIBKRKSA-N |
| XLogP | 4.55 |
| TPSA | 117.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.45 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|