C21H23BN4O5 — CID 172966284
ethyl N-[6-[(1-hydroxy-3,3-dimethyl-2,1-benzoxaborol-6-yl)methylcarbamoyl]-1H-benzimidazol-2-yl]carbamate (PubChem CID 172966284) has the molecular formula C21H23BN4O5 and a molecular weight of 422.25 g/mol. Its IUPAC name is ethyl N-[6-[(1-hydroxy-3,3-dimethyl-2,1-benzoxaborol-6-yl)methylcarbamoyl]-1H-benzimidazol-2-yl]carbamate.
| Compound Name | ethyl N-[6-[(1-hydroxy-3,3-dimethyl-2,1-benzoxaborol-6-yl)methylcarbamoyl]-1H-benzimidazol-2-yl]carbamate |
|---|---|
| PubChem CID | 172966284 |
| Molecular Formula | C21H23BN4O5 |
| Molecular Weight | 422.25 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | ethyl N-[6-[(1-hydroxy-3,3-dimethyl-2,1-benzoxaborol-6-yl)methylcarbamoyl]-1H-benzimidazol-2-yl]carbamate |
| SMILES | CCOC(=O)Nc1nc2ccc(C(=O)NCc3ccc4c(c3)B(O)OC4(C)C)cc2[nH]1 |
| InChI | InChI=1S/C21H23BN4O5/c1-4-30-20(28)26-19-24-16-8-6-13(10-17(16)25-19)18(27)23-11-12-5-7-14-15(9-12)22(29)31-21(14,2)3/h5-10,29H,4,11H2,1-3H3,(H,23,27)(H2,24,25,26,28) |
| InChIKey | UZIFHYYSXGANTH-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 125.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.25 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|