C24H29ClN2O8 — CID 172967279
2-[(Z)-[(4R,6R,8R,9Z)-16-chloro-17,19-dihydroxy-4-methyl-2-oxo-3,7-dioxatricyclo[13.4.0.06,8]nonadeca-1(15),9,11,16,18-pentaen-13-ylidene]amino]oxy-N-(2-ethoxyethyl)acetamide (PubChem CID 172967279) has the molecular formula C24H29ClN2O8 and a molecular weight of 508.96 g/mol. Its IUPAC name is 2-[(Z)-[(4R,6R,8R,9Z)-16-chloro-17,19-dihydroxy-4-methyl-2-oxo-3,7-dioxatricyclo[13.4.0.06,8]nonadeca-1(15),9,11,16,18-pentaen-13-ylidene]amino]oxy-N-(2-ethoxyethyl)acetamide.
| Compound Name | 2-[(Z)-[(4R,6R,8R,9Z)-16-chloro-17,19-dihydroxy-4-methyl-2-oxo-3,7-dioxatricyclo[13.4.0.06,8]nonadeca-1(15),9,11,16,18-pentaen-13-ylidene]amino]oxy-N-(2-ethoxyethyl)acetamide |
|---|---|
| PubChem CID | 172967279 |
| Molecular Formula | C24H29ClN2O8 |
| Molecular Weight | 508.96 g/mol |
| Exact Mass | 508.16 |
| IUPAC Name | 2-[(Z)-[(4R,6R,8R,9Z)-16-chloro-17,19-dihydroxy-4-methyl-2-oxo-3,7-dioxatricyclo[13.4.0.06,8]nonadeca-1(15),9,11,16,18-pentaen-13-ylidene]amino]oxy-N-(2-ethoxyethyl)acetamide |
| SMILES | CCOCCNC(=O)CO/N=C1\C=C/C=C\[C@H]2O[C@@H]2C[C@@H](C)OC(=O)c2c(O)cc(O)c(Cl)c2C1 |
| InChI | InChI=1S/C24H29ClN2O8/c1-3-32-9-8-26-21(30)13-33-27-15-6-4-5-7-19-20(35-19)10-14(2)34-24(31)22-16(11-15)23(25)18(29)12-17(22)28/h4-7,12,14,19-20,28-29H,3,8-11,13H2,1-2H3,(H,26,30)/b6-4?,7-5-,27-15+/t14-,19-,20-/m1/s1 |
| InChIKey | PHPBXALSGRFDIK-KNBFVZBESA-N |
| XLogP | 2.65 |
| TPSA | 139.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.96 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|