C19H27N5O2 — CID 172968221
3-[1-[2-(4-aminopiperidin-1-yl)acetyl]piperidin-4-yl]-1H-benzimidazol-2-one (PubChem CID 172968221) has the molecular formula C19H27N5O2 and a molecular weight of 357.46 g/mol. Its IUPAC name is 3-[1-[2-(4-aminopiperidin-1-yl)acetyl]piperidin-4-yl]-1H-benzimidazol-2-one.
| Compound Name | 3-[1-[2-(4-aminopiperidin-1-yl)acetyl]piperidin-4-yl]-1H-benzimidazol-2-one |
|---|---|
| PubChem CID | 172968221 |
| Molecular Formula | C19H27N5O2 |
| Molecular Weight | 357.46 g/mol |
| Exact Mass | 357.22 |
| IUPAC Name | 3-[1-[2-(4-aminopiperidin-1-yl)acetyl]piperidin-4-yl]-1H-benzimidazol-2-one |
| SMILES | NC1CCN(CC(=O)N2CCC(n3c(=O)[nH]c4ccccc43)CC2)CC1 |
| InChI | InChI=1S/C19H27N5O2/c20-14-5-9-22(10-6-14)13-18(25)23-11-7-15(8-12-23)24-17-4-2-1-3-16(17)21-19(24)26/h1-4,14-15H,5-13,20H2,(H,21,26) |
| InChIKey | QVAPKAIBOZDAPX-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 87.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.46 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |