C14H16ClN3O6S — CID 172969557
4-[bis(cyclopropylmethyl)amino]-3,5-dinitrobenzenesulfonyl chloride (PubChem CID 172969557) has the molecular formula C14H16ClN3O6S and a molecular weight of 389.82 g/mol. Its IUPAC name is 4-[bis(cyclopropylmethyl)amino]-3,5-dinitrobenzenesulfonyl chloride.
| Compound Name | 4-[bis(cyclopropylmethyl)amino]-3,5-dinitrobenzenesulfonyl chloride |
|---|---|
| PubChem CID | 172969557 |
| Molecular Formula | C14H16ClN3O6S |
| Molecular Weight | 389.82 g/mol |
| Exact Mass | 389.04 |
| IUPAC Name | 4-[bis(cyclopropylmethyl)amino]-3,5-dinitrobenzenesulfonyl chloride |
| SMILES | O=[N+]([O-])c1cc(S(=O)(=O)Cl)cc([N+](=O)[O-])c1N(CC1CC1)CC1CC1 |
| InChI | InChI=1S/C14H16ClN3O6S/c15-25(23,24)11-5-12(17(19)20)14(13(6-11)18(21)22)16(7-9-1-2-9)8-10-3-4-10/h5-6,9-10H,1-4,7-8H2 |
| InChIKey | XPMIVLJUWLBIEJ-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.82 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|