C25H31ClFN7O — CID 172970711
5-[[4-[4-(2-chlorophenyl)piperazin-1-yl]-6-(3-fluoro-4-methylanilino)-1,3,5-triazin-2-yl]amino]pentan-1-ol (PubChem CID 172970711) has the molecular formula C25H31ClFN7O and a molecular weight of 500.02 g/mol. Its IUPAC name is 5-[[4-[4-(2-chlorophenyl)piperazin-1-yl]-6-(3-fluoro-4-methylanilino)-1,3,5-triazin-2-yl]amino]pentan-1-ol.
| Compound Name | 5-[[4-[4-(2-chlorophenyl)piperazin-1-yl]-6-(3-fluoro-4-methylanilino)-1,3,5-triazin-2-yl]amino]pentan-1-ol |
|---|---|
| PubChem CID | 172970711 |
| Molecular Formula | C25H31ClFN7O |
| Molecular Weight | 500.02 g/mol |
| Exact Mass | 499.23 |
| IUPAC Name | 5-[[4-[4-(2-chlorophenyl)piperazin-1-yl]-6-(3-fluoro-4-methylanilino)-1,3,5-triazin-2-yl]amino]pentan-1-ol |
| SMILES | Cc1ccc(Nc2nc(NCCCCCO)nc(N3CCN(c4ccccc4Cl)CC3)n2)cc1F |
| InChI | InChI=1S/C25H31ClFN7O/c1-18-9-10-19(17-21(18)27)29-24-30-23(28-11-5-2-6-16-35)31-25(32-24)34-14-12-33(13-15-34)22-8-4-3-7-20(22)26/h3-4,7-10,17,35H,2,5-6,11-16H2,1H3,(H2,28,29,30,31,32) |
| InChIKey | PZBWLLCMYXOPNJ-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 89.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.02 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|