C16H16N3NaO4 — CID 172971539
sodium (2R,3R,6E)-3-[(E)-methoxyiminomethyl]-3-methyl-7-oxo-6-(pyridin-2-ylmethylidene)-1-azabicyclo[3.2.0]heptane-2-carboxylate (PubChem CID 172971539) has the molecular formula C16H16N3NaO4 and a molecular weight of 337.31 g/mol. Its IUPAC name is sodium (2R,3R,6E)-3-[(E)-methoxyiminomethyl]-3-methyl-7-oxo-6-(pyridin-2-ylmethylidene)-1-azabicyclo[3.2.0]heptane-2-carboxylate.
| Compound Name | sodium (2R,3R,6E)-3-[(E)-methoxyiminomethyl]-3-methyl-7-oxo-6-(pyridin-2-ylmethylidene)-1-azabicyclo[3.2.0]heptane-2-carboxylate |
|---|---|
| PubChem CID | 172971539 |
| Molecular Formula | C16H16N3NaO4 |
| Molecular Weight | 337.31 g/mol |
| Exact Mass | 337.10 |
| IUPAC Name | sodium (2R,3R,6E)-3-[(E)-methoxyiminomethyl]-3-methyl-7-oxo-6-(pyridin-2-ylmethylidene)-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| SMILES | CO/N=C/[C@]1(C)CC2/C(=C\c3ccccn3)C(=O)N2[C@H]1C(=O)[O-].[Na+] |
| InChI | InChI=1S/C16H17N3O4.Na/c1-16(9-18-23-2)8-12-11(7-10-5-3-4-6-17-10)14(20)19(12)13(16)15(21)22;/h3-7,9,12-13H,8H2,1-2H3,(H,21,22);/q;+1/p-1/b11-7+,18-9+;/t12?,13-,16-;/m0./s1 |
| InChIKey | BRGMWIRTOJHXCJ-IBZBOCJESA-M |
| XLogP | -3.16 |
| TPSA | 94.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.31 |
| LogP ≤ 5 | -3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|