C18H16N2O3S — CID 17297257
2-benzylsulfanyl-N-(1,3-dioxoisoindol-5-yl)propanamide (PubChem CID 17297257) has the molecular formula C18H16N2O3S and a molecular weight of 340.40 g/mol. Its IUPAC name is 2-benzylsulfanyl-N-(1,3-dioxoisoindol-5-yl)propanamide.
| Compound Name | 2-benzylsulfanyl-N-(1,3-dioxoisoindol-5-yl)propanamide |
|---|---|
| PubChem CID | 17297257 |
| Molecular Formula | C18H16N2O3S |
| Molecular Weight | 340.40 g/mol |
| Exact Mass | 340.09 |
| IUPAC Name | 2-benzylsulfanyl-N-(1,3-dioxoisoindol-5-yl)propanamide |
| SMILES | CC(SCc1ccccc1)C(=O)Nc1ccc2c(c1)C(=O)NC2=O |
| InChI | InChI=1S/C18H16N2O3S/c1-11(24-10-12-5-3-2-4-6-12)16(21)19-13-7-8-14-15(9-13)18(23)20-17(14)22/h2-9,11H,10H2,1H3,(H,19,21)(H,20,22,23) |
| InChIKey | DMJDQBUCNVVOEC-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.40 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|