C18H17ClFN3O5 — CID 172972606
(2R,3S,4R,5R)-2-[(R)-(3-chloro-4-fluorophenyl)-hydroxymethyl]-5-[(4E)-4-hydroxyimino-7H-pyrrolo[3,2-c]pyridin-1-yl]oxolane-3,4-diol (PubChem CID 172972606) has the molecular formula C18H17ClFN3O5 and a molecular weight of 409.80 g/mol. Its IUPAC name is (2R,3S,4R,5R)-2-[(R)-(3-chloro-4-fluorophenyl)-hydroxymethyl]-5-[(4E)-4-hydroxyimino-7H-pyrrolo[3,2-c]pyridin-1-yl]oxolane-3,4-diol.
| Compound Name | (2R,3S,4R,5R)-2-[(R)-(3-chloro-4-fluorophenyl)-hydroxymethyl]-5-[(4E)-4-hydroxyimino-7H-pyrrolo[3,2-c]pyridin-1-yl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 172972606 |
| Molecular Formula | C18H17ClFN3O5 |
| Molecular Weight | 409.80 g/mol |
| Exact Mass | 409.08 |
| IUPAC Name | (2R,3S,4R,5R)-2-[(R)-(3-chloro-4-fluorophenyl)-hydroxymethyl]-5-[(4E)-4-hydroxyimino-7H-pyrrolo[3,2-c]pyridin-1-yl]oxolane-3,4-diol |
| SMILES | O/N=C1/N=CCc2c1ccn2[C@@H]1O[C@H]([C@H](O)c2ccc(F)c(Cl)c2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C18H17ClFN3O5/c19-10-7-8(1-2-11(10)20)13(24)16-14(25)15(26)18(28-16)23-6-4-9-12(23)3-5-21-17(9)22-27/h1-2,4-7,13-16,18,24-27H,3H2/b22-17+/t13-,14+,15-,16-,18-/m1/s1 |
| InChIKey | IDDXHFPPPHRDFA-IYSYYZFPSA-N |
| XLogP | 1.40 |
| TPSA | 119.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.80 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|