C32H28F3N5O5S2 — CID 172973340
N'-amino-N-imino-2-[3-[4-[[(2-methylnaphthalen-1-yl)sulfonyl-[[5-(trifluoromethyl)furan-2-yl]methyl]amino]methyl]phenyl]phenyl]sulfonylethanimidamide (PubChem CID 172973340) has the molecular formula C32H28F3N5O5S2 and a molecular weight of 683.73 g/mol. Its IUPAC name is N'-amino-N-imino-2-[3-[4-[[(2-methylnaphthalen-1-yl)sulfonyl-[[5-(trifluoromethyl)furan-2-yl]methyl]amino]methyl]phenyl]phenyl]sulfonylethanimidamide.
| Compound Name | N'-amino-N-imino-2-[3-[4-[[(2-methylnaphthalen-1-yl)sulfonyl-[[5-(trifluoromethyl)furan-2-yl]methyl]amino]methyl]phenyl]phenyl]sulfonylethanimidamide |
|---|---|
| PubChem CID | 172973340 |
| Molecular Formula | C32H28F3N5O5S2 |
| Molecular Weight | 683.73 g/mol |
| Exact Mass | 683.15 |
| IUPAC Name | N'-amino-N-imino-2-[3-[4-[[(2-methylnaphthalen-1-yl)sulfonyl-[[5-(trifluoromethyl)furan-2-yl]methyl]amino]methyl]phenyl]phenyl]sulfonylethanimidamide |
| SMILES | [H]/N=N/C(CS(=O)(=O)c1cccc(-c2ccc(CN(Cc3ccc(C(F)(F)F)o3)S(=O)(=O)c3c(C)ccc4ccccc34)cc2)c1)=N\N |
| InChI | InChI=1S/C32H28F3N5O5S2/c1-21-9-12-24-5-2-3-8-28(24)31(21)47(43,44)40(19-26-15-16-29(45-26)32(33,34)35)18-22-10-13-23(14-11-22)25-6-4-7-27(17-25)46(41,42)20-30(38-36)39-37/h2-17,36H,18-20,37H2,1H3/b38-36+,39-30- |
| InChIKey | ZVUPXBUYZAJESF-WOPXDTKNSA-N |
| XLogP | 6.89 |
| TPSA | 159.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.73 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|