C15H13IN5O2S- — CID 172975108
4-[(E)-(4-hydroxy-3-methyliodanuidyloxyphenyl)methylideneamino]-3-pyridin-4-yl-1H-1,2,4-triazole-5-thione (PubChem CID 172975108) has the molecular formula C15H13IN5O2S- and a molecular weight of 454.27 g/mol. Its IUPAC name is 4-[(E)-(4-hydroxy-3-methyliodanuidyloxyphenyl)methylideneamino]-3-pyridin-4-yl-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-[(E)-(4-hydroxy-3-methyliodanuidyloxyphenyl)methylideneamino]-3-pyridin-4-yl-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 172975108 |
| Molecular Formula | C15H13IN5O2S- |
| Molecular Weight | 454.27 g/mol |
| Exact Mass | 453.98 |
| IUPAC Name | 4-[(E)-(4-hydroxy-3-methyliodanuidyloxyphenyl)methylideneamino]-3-pyridin-4-yl-1H-1,2,4-triazole-5-thione |
| SMILES | C[I-]Oc1cc(/C=N/n2c(-c3ccncc3)n[nH]c2=S)ccc1O |
| InChI | InChI=1S/C15H13IN5O2S/c1-16-23-13-8-10(2-3-12(13)22)9-18-21-14(19-20-15(21)24)11-4-6-17-7-5-11/h2-9,22H,1H3,(H,20,24)/q-1/b18-9+ |
| InChIKey | PAXVZUOELFLBIM-GIJQJNRQSA-N |
| XLogP | -0.40 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.27 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|